C14H21ClF3N3O3S — CID 119503433
N-[2-(methylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride (PubChem CID 119503433) has the molecular formula C14H21ClF3N3O3S and a molecular weight of 403.85 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119503433 |
| Molecular Formula | C14H21ClF3N3O3S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[2-(methylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride |
| SMILES | CNCCNC(=O)CCCNS(=O)(=O)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C14H20F3N3O3S.ClH/c1-18-8-9-19-13(21)6-3-7-20-24(22,23)12-5-2-4-11(10-12)14(15,16)17;/h2,4-5,10,18,20H,3,6-9H2,1H3,(H,19,21);1H |
| InChIKey | GJCSSHKURYIVJL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|