C15H22F3NO2S — CID 67803477
N-octyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 67803477) has the molecular formula C15H22F3NO2S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-octyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-octyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67803477 |
| Molecular Formula | C15H22F3NO2S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-octyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCCCCCCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3NO2S/c1-2-3-4-5-6-7-11-19-22(20,21)14-10-8-9-13(12-14)15(16,17)18/h8-10,12,19H,2-7,11H2,1H3 |
| InChIKey | BWSLVYUGDLZRAR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|