C9H7F3N2O2S — CID 3780840
N-(cyanomethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 3780840) has the molecular formula C9H7F3N2O2S and a molecular weight of 264.23 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(cyanomethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3780840 |
| Molecular Formula | C9H7F3N2O2S |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | N-(cyanomethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | N#CCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3N2O2S/c10-9(11,12)7-2-1-3-8(6-7)17(15,16)14-5-4-13/h1-3,6,14H,5H2 |
| InChIKey | OZJCSHQWINWZHT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|