C11H13BrF3NO2S — CID 113271804
N-(3-bromobutyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 113271804) has the molecular formula C11H13BrF3NO2S and a molecular weight of 360.20 g/mol. Its IUPAC name is N-(3-bromobutyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-bromobutyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113271804 |
| Molecular Formula | C11H13BrF3NO2S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-(3-bromobutyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(Br)CCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13BrF3NO2S/c1-8(12)5-6-16-19(17,18)10-4-2-3-9(7-10)11(13,14)15/h2-4,7-8,16H,5-6H2,1H3 |
| InChIKey | SDPGYCYSIXMFAD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|