C9H9ClF3NO4S2 — CID 81358830
2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethanesulfonyl chloride (PubChem CID 81358830) has the molecular formula C9H9ClF3NO4S2 and a molecular weight of 351.76 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethanesulfonyl chloride.
| Compound Name | 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 81358830 |
| Molecular Formula | C9H9ClF3NO4S2 |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9ClF3NO4S2/c10-19(15,16)5-4-14-20(17,18)8-3-1-2-7(6-8)9(11,12)13/h1-3,6,14H,4-5H2 |
| InChIKey | GKHMFENSZBNUBI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |