C12H14F3NO4S — CID 80537664
2-methyl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 80537664) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-methyl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 2-methyl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 80537664 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-methyl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | CC(CCNS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H14F3NO4S/c1-8(11(17)18)5-6-16-21(19,20)10-4-2-3-9(7-10)12(13,14)15/h2-4,7-8,16H,5-6H2,1H3,(H,17,18) |
| InChIKey | KAAAIACINKSPTE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |