C12H14F3NO4S2 — CID 3485177
4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 3485177) has the molecular formula C12H14F3NO4S2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 3485177 |
| Molecular Formula | C12H14F3NO4S2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H14F3NO4S2/c1-21-6-5-10(11(17)18)16-22(19,20)9-4-2-3-8(7-9)12(13,14)15/h2-4,7,10,16H,5-6H2,1H3,(H,17,18) |
| InChIKey | BGORJJLXLJKFMJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |