C12H13ClF3NO4S2 — CID 3856640
2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 3856640) has the molecular formula C12H13ClF3NO4S2 and a molecular weight of 391.82 g/mol. Its IUPAC name is 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 3856640 |
| Molecular Formula | C12H13ClF3NO4S2 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13ClF3NO4S2/c1-22-5-4-9(11(18)19)17-23(20,21)10-6-7(12(14,15)16)2-3-8(10)13/h2-3,6,9,17H,4-5H2,1H3,(H,18,19) |
| InChIKey | NFYOXOIDASVLEH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |