C11H13ClFNO4S — CID 104739176
2-[(2-chloro-5-fluorophenyl)sulfonylamino]pentanoic acid (PubChem CID 104739176) has the molecular formula C11H13ClFNO4S and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorophenyl)sulfonylamino]pentanoic acid.
| Compound Name | 2-[(2-chloro-5-fluorophenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 104739176 |
| Molecular Formula | C11H13ClFNO4S |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[(2-chloro-5-fluorophenyl)sulfonylamino]pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)c1cc(F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H13ClFNO4S/c1-2-3-9(11(15)16)14-19(17,18)10-6-7(13)4-5-8(10)12/h4-6,9,14H,2-3H2,1H3,(H,15,16) |
| InChIKey | UULYKUMZXHZZOA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |