C10H11ClFNO5S — CID 114517798
2-[(2-chloro-5-fluorophenyl)sulfonylamino]-3-hydroxybutanoic acid (PubChem CID 114517798) has the molecular formula C10H11ClFNO5S and a molecular weight of 311.72 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorophenyl)sulfonylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(2-chloro-5-fluorophenyl)sulfonylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114517798 |
| Molecular Formula | C10H11ClFNO5S |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-[(2-chloro-5-fluorophenyl)sulfonylamino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NS(=O)(=O)c1cc(F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C10H11ClFNO5S/c1-5(14)9(10(15)16)13-19(17,18)8-4-6(12)2-3-7(8)11/h2-5,9,13-14H,1H3,(H,15,16) |
| InChIKey | QVZCYSPDRQVMMY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |