C12H16FNO4S — CID 79010727
(2R)-2-[(5-fluoro-2-methylphenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 79010727) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R)-2-[(5-fluoro-2-methylphenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(5-fluoro-2-methylphenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79010727 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (2R)-2-[(5-fluoro-2-methylphenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C12H16FNO4S/c1-7(2)11(12(15)16)14-19(17,18)10-6-9(13)5-4-8(10)3/h4-7,11,14H,1-3H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | HJXPPYCDYUAQTN-LLVKDONJSA-N |
| XLogP | 1.52 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |