C11H15ClFNO3S — CID 113381999
2-chloro-5-fluoro-N-(4-hydroxypentan-2-yl)benzenesulfonamide (PubChem CID 113381999) has the molecular formula C11H15ClFNO3S and a molecular weight of 295.76 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(4-hydroxypentan-2-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-fluoro-N-(4-hydroxypentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113381999 |
| Molecular Formula | C11H15ClFNO3S |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-chloro-5-fluoro-N-(4-hydroxypentan-2-yl)benzenesulfonamide |
| SMILES | CC(O)CC(C)NS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H15ClFNO3S/c1-7(5-8(2)15)14-18(16,17)11-6-9(13)3-4-10(11)12/h3-4,6-8,14-15H,5H2,1-2H3 |
| InChIKey | OMFLGTAXBBSMIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |