C11H12ClNO7S — CID 7745996
3-[[(1R,2S)-1-carboxy-2-hydroxypropyl]sulfamoyl]-4-chlorobenzoic acid (PubChem CID 7745996) has the molecular formula C11H12ClNO7S and a molecular weight of 337.74 g/mol. Its IUPAC name is 3-[[(1R,2S)-1-carboxy-2-hydroxypropyl]sulfamoyl]-4-chlorobenzoic acid.
| Compound Name | 3-[[(1R,2S)-1-carboxy-2-hydroxypropyl]sulfamoyl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 7745996 |
| Molecular Formula | C11H12ClNO7S |
| Molecular Weight | 337.74 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 3-[[(1R,2S)-1-carboxy-2-hydroxypropyl]sulfamoyl]-4-chlorobenzoic acid |
| SMILES | C[C@H](O)[C@@H](NS(=O)(=O)c1cc(C(=O)O)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12ClNO7S/c1-5(14)9(11(17)18)13-21(19,20)8-4-6(10(15)16)2-3-7(8)12/h2-5,9,13-14H,1H3,(H,15,16)(H,17,18)/t5-,9+/m0/s1 |
| InChIKey | DOYNNVXSRGDMPK-SSDLBLMSSA-N |
| XLogP | 0.15 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.74 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |