C12H16ClNO5S — CID 79254529
4-chloro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid (PubChem CID 79254529) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 4-chloro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79254529 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-chloro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid |
| SMILES | CC(C)[C@@H](CO)NS(=O)(=O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H16ClNO5S/c1-7(2)10(6-15)14-20(18,19)11-5-8(12(16)17)3-4-9(11)13/h3-5,7,10,14-15H,6H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | JDORDHVLDXFLPP-SNVBAGLBSA-N |
| XLogP | 1.33 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |