C12H15ClFNO5S — CID 79236454
5-chloro-2-fluoro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid (PubChem CID 79236454) has the molecular formula C12H15ClFNO5S and a molecular weight of 339.77 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79236454 |
| Molecular Formula | C12H15ClFNO5S |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 5-chloro-2-fluoro-3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]benzoic acid |
| SMILES | CC(C)[C@@H](CO)NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C12H15ClFNO5S/c1-6(2)9(5-16)15-21(19,20)10-4-7(13)3-8(11(10)14)12(17)18/h3-4,6,9,15-16H,5H2,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | DMHSRYCFTACTIY-SECBINFHSA-N |
| XLogP | 1.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |