C9H9ClFNO5S — CID 43498357
5-chloro-2-fluoro-3-(2-hydroxyethylsulfamoyl)benzoic acid (PubChem CID 43498357) has the molecular formula C9H9ClFNO5S and a molecular weight of 297.69 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-(2-hydroxyethylsulfamoyl)benzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-(2-hydroxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43498357 |
| Molecular Formula | C9H9ClFNO5S |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 5-chloro-2-fluoro-3-(2-hydroxyethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)NCCO)c1F |
| InChI | InChI=1S/C9H9ClFNO5S/c10-5-3-6(9(14)15)8(11)7(4-5)18(16,17)12-1-2-13/h3-4,12-13H,1-2H2,(H,14,15) |
| InChIKey | SHWXGMOIPWVNCQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |