C11H12ClFN2O5S — CID 43310943
5-chloro-3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-fluorobenzoic acid (PubChem CID 43310943) has the molecular formula C11H12ClFN2O5S and a molecular weight of 338.74 g/mol. Its IUPAC name is 5-chloro-3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-fluorobenzoic acid.
| Compound Name | 5-chloro-3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43310943 |
| Molecular Formula | C11H12ClFN2O5S |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-chloro-3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-fluorobenzoic acid |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C11H12ClFN2O5S/c1-15(2)9(16)5-14-21(19,20)8-4-6(12)3-7(10(8)13)11(17)18/h3-4,14H,5H2,1-2H3,(H,17,18) |
| InChIKey | LMRAPCLPNAZGJX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |