C12H13ClFNO5S — CID 43309816
5-chloro-3-[2-[ethyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid (PubChem CID 43309816) has the molecular formula C12H13ClFNO5S and a molecular weight of 337.76 g/mol. Its IUPAC name is 5-chloro-3-[2-[ethyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-chloro-3-[2-[ethyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43309816 |
| Molecular Formula | C12H13ClFNO5S |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5-chloro-3-[2-[ethyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid |
| SMILES | CCN(C)C(=O)CS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C12H13ClFNO5S/c1-3-15(2)10(16)6-21(19,20)9-5-7(13)4-8(11(9)14)12(17)18/h4-5H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | CJCZVWUNSZXPRV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |