C9H7ClF2O4S — CID 80694120
5-chloro-2-fluoro-3-(2-fluoroethylsulfonyl)benzoic acid (PubChem CID 80694120) has the molecular formula C9H7ClF2O4S and a molecular weight of 284.67 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-(2-fluoroethylsulfonyl)benzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-(2-fluoroethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 80694120 |
| Molecular Formula | C9H7ClF2O4S |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 5-chloro-2-fluoro-3-(2-fluoroethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)CCF)c1F |
| InChI | InChI=1S/C9H7ClF2O4S/c10-5-3-6(9(13)14)8(12)7(4-5)17(15,16)2-1-11/h3-4H,1-2H2,(H,13,14) |
| InChIKey | PZPISAXTDQMSRE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |