C14H16ClFO4S — CID 43323203
5-chloro-3-(cyclohexylmethylsulfonyl)-2-fluorobenzoic acid (PubChem CID 43323203) has the molecular formula C14H16ClFO4S and a molecular weight of 334.80 g/mol. Its IUPAC name is 5-chloro-3-(cyclohexylmethylsulfonyl)-2-fluorobenzoic acid.
| Compound Name | 5-chloro-3-(cyclohexylmethylsulfonyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43323203 |
| Molecular Formula | C14H16ClFO4S |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-chloro-3-(cyclohexylmethylsulfonyl)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)CC2CCCCC2)c1F |
| InChI | InChI=1S/C14H16ClFO4S/c15-10-6-11(14(17)18)13(16)12(7-10)21(19,20)8-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H,17,18) |
| InChIKey | MZFFKOHYWUUUFD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |