C14H17Cl2FN2O3S — CID 134581051
3,5-dichloro-N'-(cyclohexylmethylsulfonyl)-2-fluorobenzohydrazide (PubChem CID 134581051) has the molecular formula C14H17Cl2FN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 3,5-dichloro-N'-(cyclohexylmethylsulfonyl)-2-fluorobenzohydrazide.
| Compound Name | 3,5-dichloro-N'-(cyclohexylmethylsulfonyl)-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 134581051 |
| Molecular Formula | C14H17Cl2FN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 3,5-dichloro-N'-(cyclohexylmethylsulfonyl)-2-fluorobenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)CC1CCCCC1)c1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C14H17Cl2FN2O3S/c15-10-6-11(13(17)12(16)7-10)14(20)18-19-23(21,22)8-9-4-2-1-3-5-9/h6-7,9,19H,1-5,8H2,(H,18,20) |
| InChIKey | SBOWFBVACFMQPW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|