C14H16Cl2FNO4S — CID 167624082
N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]-1-(oxan-4-yl)methanesulfonamide (PubChem CID 167624082) has the molecular formula C14H16Cl2FNO4S and a molecular weight of 384.26 g/mol. Its IUPAC name is N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]-1-(oxan-4-yl)methanesulfonamide.
| Compound Name | N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]-1-(oxan-4-yl)methanesulfonamide |
|---|---|
| PubChem CID | 167624082 |
| Molecular Formula | C14H16Cl2FNO4S |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]-1-(oxan-4-yl)methanesulfonamide |
| SMILES | O=C(CNS(=O)(=O)CC1CCOCC1)c1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C14H16Cl2FNO4S/c15-10-5-11(14(17)12(16)6-10)13(19)7-18-23(20,21)8-9-1-3-22-4-2-9/h5-6,9,18H,1-4,7-8H2 |
| InChIKey | LIZHYWFVNKFIHQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|