C14H17ClFNO5S — CID 167570070
N-[2-[3-chloro-2-fluoro-5-(hydroxymethyl)phenyl]-2-oxoethyl]oxane-4-sulfonamide (PubChem CID 167570070) has the molecular formula C14H17ClFNO5S and a molecular weight of 365.81 g/mol. Its IUPAC name is N-[2-[3-chloro-2-fluoro-5-(hydroxymethyl)phenyl]-2-oxoethyl]oxane-4-sulfonamide.
| Compound Name | N-[2-[3-chloro-2-fluoro-5-(hydroxymethyl)phenyl]-2-oxoethyl]oxane-4-sulfonamide |
|---|---|
| PubChem CID | 167570070 |
| Molecular Formula | C14H17ClFNO5S |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-[2-[3-chloro-2-fluoro-5-(hydroxymethyl)phenyl]-2-oxoethyl]oxane-4-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)C1CCOCC1)c1cc(CO)cc(Cl)c1F |
| InChI | InChI=1S/C14H17ClFNO5S/c15-12-6-9(8-18)5-11(14(12)16)13(19)7-17-23(20,21)10-1-3-22-4-2-10/h5-6,10,17-18H,1-4,7-8H2 |
| InChIKey | HGZQMAFKGOKLFK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |