C20H20ClF2NO3S — CID 167659738
N-[2-[3-chloro-2-fluoro-5-(2-fluorophenyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide (PubChem CID 167659738) has the molecular formula C20H20ClF2NO3S and a molecular weight of 427.90 g/mol. Its IUPAC name is N-[2-[3-chloro-2-fluoro-5-(2-fluorophenyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide.
| Compound Name | N-[2-[3-chloro-2-fluoro-5-(2-fluorophenyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 167659738 |
| Molecular Formula | C20H20ClF2NO3S |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[2-[3-chloro-2-fluoro-5-(2-fluorophenyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide |
| SMILES | O=C(CNS(=O)(=O)C1CCCCC1)c1cc(-c2ccccc2F)cc(Cl)c1F |
| InChI | InChI=1S/C20H20ClF2NO3S/c21-17-11-13(15-8-4-5-9-18(15)22)10-16(20(17)23)19(25)12-24-28(26,27)14-6-2-1-3-7-14/h4-5,8-11,14,24H,1-3,6-7,12H2 |
| InChIKey | IOQDWWUBHZFLSA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |