C20H21ClF2N2O3S — CID 134581227
5-(2-chloro-3-fluorophenyl)-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide (PubChem CID 134581227) has the molecular formula C20H21ClF2N2O3S and a molecular weight of 442.92 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 134581227 |
| Molecular Formula | C20H21ClF2N2O3S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide |
| SMILES | Cc1cc(-c2cccc(F)c2Cl)cc(C(=O)NNS(=O)(=O)C2CCCCC2)c1F |
| InChI | InChI=1S/C20H21ClF2N2O3S/c1-12-10-13(15-8-5-9-17(22)18(15)21)11-16(19(12)23)20(26)24-25-29(27,28)14-6-3-2-4-7-14/h5,8-11,14,25H,2-4,6-7H2,1H3,(H,24,26) |
| InChIKey | PGBUTCQQABJUAN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|