C25H26FN3O3S — CID 134581287
2-fluoro-3-methyl-5-phenyl-N'-[1-(2-phenylethyl)azetidin-3-yl]sulfonylbenzohydrazide (PubChem CID 134581287) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-phenyl-N'-[1-(2-phenylethyl)azetidin-3-yl]sulfonylbenzohydrazide.
| Compound Name | 2-fluoro-3-methyl-5-phenyl-N'-[1-(2-phenylethyl)azetidin-3-yl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 134581287 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-fluoro-3-methyl-5-phenyl-N'-[1-(2-phenylethyl)azetidin-3-yl]sulfonylbenzohydrazide |
| SMILES | Cc1cc(-c2ccccc2)cc(C(=O)NNS(=O)(=O)C2CN(CCc3ccccc3)C2)c1F |
| InChI | InChI=1S/C25H26FN3O3S/c1-18-14-21(20-10-6-3-7-11-20)15-23(24(18)26)25(30)27-28-33(31,32)22-16-29(17-22)13-12-19-8-4-2-5-9-19/h2-11,14-15,22,28H,12-13,16-17H2,1H3,(H,27,30) |
| InChIKey | MMFBHYPBLXSHES-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|