C24H30FN3O3S — CID 142366186
tert-butyl 4-[2-(2-fluoro-3-methyl-5-phenylbenzoyl)hydrazinyl]sulfanylpiperidine-1-carboxylate (PubChem CID 142366186) has the molecular formula C24H30FN3O3S and a molecular weight of 459.59 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-fluoro-3-methyl-5-phenylbenzoyl)hydrazinyl]sulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-fluoro-3-methyl-5-phenylbenzoyl)hydrazinyl]sulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142366186 |
| Molecular Formula | C24H30FN3O3S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | tert-butyl 4-[2-(2-fluoro-3-methyl-5-phenylbenzoyl)hydrazinyl]sulfanylpiperidine-1-carboxylate |
| SMILES | Cc1cc(-c2ccccc2)cc(C(=O)NNSC2CCN(C(=O)OC(C)(C)C)CC2)c1F |
| InChI | InChI=1S/C24H30FN3O3S/c1-16-14-18(17-8-6-5-7-9-17)15-20(21(16)25)22(29)26-27-32-19-10-12-28(13-11-19)23(30)31-24(2,3)4/h5-9,14-15,19,27H,10-13H2,1-4H3,(H,26,29) |
| InChIKey | ANUGDMADDFZCQZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|