C21H26FN3O3S — CID 134581224
2-fluoro-3-methyl-N'-[(1-methylpiperidin-3-yl)methylsulfonyl]-5-phenylbenzohydrazide (PubChem CID 134581224) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N'-[(1-methylpiperidin-3-yl)methylsulfonyl]-5-phenylbenzohydrazide.
| Compound Name | 2-fluoro-3-methyl-N'-[(1-methylpiperidin-3-yl)methylsulfonyl]-5-phenylbenzohydrazide |
|---|---|
| PubChem CID | 134581224 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-fluoro-3-methyl-N'-[(1-methylpiperidin-3-yl)methylsulfonyl]-5-phenylbenzohydrazide |
| SMILES | Cc1cc(-c2ccccc2)cc(C(=O)NNS(=O)(=O)CC2CCCN(C)C2)c1F |
| InChI | InChI=1S/C21H26FN3O3S/c1-15-11-18(17-8-4-3-5-9-17)12-19(20(15)22)21(26)23-24-29(27,28)14-16-7-6-10-25(2)13-16/h3-5,8-9,11-12,16,24H,6-7,10,13-14H2,1-2H3,(H,23,26) |
| InChIKey | BATCAPXYBZNPDS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|