C25H32F2N4O4S — CID 134581327
N'-[[1-[3-(dimethylamino)propanoyl]piperidin-3-yl]methylsulfonyl]-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide (PubChem CID 134581327) has the molecular formula C25H32F2N4O4S and a molecular weight of 522.62 g/mol. Its IUPAC name is N'-[[1-[3-(dimethylamino)propanoyl]piperidin-3-yl]methylsulfonyl]-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide.
| Compound Name | N'-[[1-[3-(dimethylamino)propanoyl]piperidin-3-yl]methylsulfonyl]-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 134581327 |
| Molecular Formula | C25H32F2N4O4S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | N'-[[1-[3-(dimethylamino)propanoyl]piperidin-3-yl]methylsulfonyl]-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide |
| SMILES | Cc1cc(-c2cccc(F)c2)cc(C(=O)NNS(=O)(=O)CC2CCCN(C(=O)CCN(C)C)C2)c1F |
| InChI | InChI=1S/C25H32F2N4O4S/c1-17-12-20(19-7-4-8-21(26)13-19)14-22(24(17)27)25(33)28-29-36(34,35)16-18-6-5-10-31(15-18)23(32)9-11-30(2)3/h4,7-8,12-14,18,29H,5-6,9-11,15-16H2,1-3H3,(H,28,33) |
| InChIKey | JDUCZLXNONRABR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|