C23H28FN3O5S — CID 134581034
2-fluoro-N'-[[1-(2-methoxyacetyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide (PubChem CID 134581034) has the molecular formula C23H28FN3O5S and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-fluoro-N'-[[1-(2-methoxyacetyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide.
| Compound Name | 2-fluoro-N'-[[1-(2-methoxyacetyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide |
|---|---|
| PubChem CID | 134581034 |
| Molecular Formula | C23H28FN3O5S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-fluoro-N'-[[1-(2-methoxyacetyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide |
| SMILES | COCC(=O)N1CCC(CS(=O)(=O)NNC(=O)c2cc(-c3ccccc3)cc(C)c2F)CC1 |
| InChI | InChI=1S/C23H28FN3O5S/c1-16-12-19(18-6-4-3-5-7-18)13-20(22(16)24)23(29)25-26-33(30,31)15-17-8-10-27(11-9-17)21(28)14-32-2/h3-7,12-13,17,26H,8-11,14-15H2,1-2H3,(H,25,29) |
| InChIKey | JMJBMEYPNWYMJM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|