C25H31F2N3O3S — CID 142366256
tert-butyl 4-[[2-[2-fluoro-5-(3-fluorophenyl)-3-methylbenzoyl]hydrazinyl]sulfanylmethyl]piperidine-1-carboxylate (PubChem CID 142366256) has the molecular formula C25H31F2N3O3S and a molecular weight of 491.60 g/mol. Its IUPAC name is tert-butyl 4-[[2-[2-fluoro-5-(3-fluorophenyl)-3-methylbenzoyl]hydrazinyl]sulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[2-fluoro-5-(3-fluorophenyl)-3-methylbenzoyl]hydrazinyl]sulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142366256 |
| Molecular Formula | C25H31F2N3O3S |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | tert-butyl 4-[[2-[2-fluoro-5-(3-fluorophenyl)-3-methylbenzoyl]hydrazinyl]sulfanylmethyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2cccc(F)c2)cc(C(=O)NNSCC2CCN(C(=O)OC(C)(C)C)CC2)c1F |
| InChI | InChI=1S/C25H31F2N3O3S/c1-16-12-19(18-6-5-7-20(26)13-18)14-21(22(16)27)23(31)28-29-34-15-17-8-10-30(11-9-17)24(32)33-25(2,3)4/h5-7,12-14,17,29H,8-11,15H2,1-4H3,(H,28,31) |
| InChIKey | XCDSIOLSDRHUTJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|