C21H24F2N2O3S — CID 134581165
N'-(cyclohexylmethylsulfonyl)-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide (PubChem CID 134581165) has the molecular formula C21H24F2N2O3S and a molecular weight of 422.50 g/mol. Its IUPAC name is N'-(cyclohexylmethylsulfonyl)-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide.
| Compound Name | N'-(cyclohexylmethylsulfonyl)-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 134581165 |
| Molecular Formula | C21H24F2N2O3S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N'-(cyclohexylmethylsulfonyl)-2-fluoro-5-(3-fluorophenyl)-3-methylbenzohydrazide |
| SMILES | Cc1cc(-c2cccc(F)c2)cc(C(=O)NNS(=O)(=O)CC2CCCCC2)c1F |
| InChI | InChI=1S/C21H24F2N2O3S/c1-14-10-17(16-8-5-9-18(22)11-16)12-19(20(14)23)21(26)24-25-29(27,28)13-15-6-3-2-4-7-15/h5,8-12,15,25H,2-4,6-7,13H2,1H3,(H,24,26) |
| InChIKey | ULMJOODXBOSQBE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|