C26H33FN2O5S — CID 167623424
3-[3-[2-(cyclohexylmethylsulfonylamino)acetyl]-4-fluoro-5-methylphenyl]-N-(2-methoxyethyl)benzamide (PubChem CID 167623424) has the molecular formula C26H33FN2O5S and a molecular weight of 504.62 g/mol. Its IUPAC name is 3-[3-[2-(cyclohexylmethylsulfonylamino)acetyl]-4-fluoro-5-methylphenyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[3-[2-(cyclohexylmethylsulfonylamino)acetyl]-4-fluoro-5-methylphenyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 167623424 |
| Molecular Formula | C26H33FN2O5S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 3-[3-[2-(cyclohexylmethylsulfonylamino)acetyl]-4-fluoro-5-methylphenyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2cc(C)c(F)c(C(=O)CNS(=O)(=O)CC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C26H33FN2O5S/c1-18-13-22(20-9-6-10-21(14-20)26(31)28-11-12-34-2)15-23(25(18)27)24(30)16-29-35(32,33)17-19-7-4-3-5-8-19/h6,9-10,13-15,19,29H,3-5,7-8,11-12,16-17H2,1-2H3,(H,28,31) |
| InChIKey | LXQHFWVPOGRSOO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|