C22H19F2NO3S — CID 167569996
N-[2-(2-fluoro-3-methyl-5-phenylphenyl)-2-oxoethyl]-1-(2-fluorophenyl)methanesulfonamide (PubChem CID 167569996) has the molecular formula C22H19F2NO3S and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[2-(2-fluoro-3-methyl-5-phenylphenyl)-2-oxoethyl]-1-(2-fluorophenyl)methanesulfonamide.
| Compound Name | N-[2-(2-fluoro-3-methyl-5-phenylphenyl)-2-oxoethyl]-1-(2-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 167569996 |
| Molecular Formula | C22H19F2NO3S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[2-(2-fluoro-3-methyl-5-phenylphenyl)-2-oxoethyl]-1-(2-fluorophenyl)methanesulfonamide |
| SMILES | Cc1cc(-c2ccccc2)cc(C(=O)CNS(=O)(=O)Cc2ccccc2F)c1F |
| InChI | InChI=1S/C22H19F2NO3S/c1-15-11-18(16-7-3-2-4-8-16)12-19(22(15)24)21(26)13-25-29(27,28)14-17-9-5-6-10-20(17)23/h2-12,25H,13-14H2,1H3 |
| InChIKey | LKSQQHYKFQBMBW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |