C20H17FN2O3S — CID 165054999
N-[2-(2-fluoro-3-methyl-5-pyridin-3-ylphenyl)-2-oxoethyl]benzenesulfonamide (PubChem CID 165054999) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[2-(2-fluoro-3-methyl-5-pyridin-3-ylphenyl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-[2-(2-fluoro-3-methyl-5-pyridin-3-ylphenyl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 165054999 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[2-(2-fluoro-3-methyl-5-pyridin-3-ylphenyl)-2-oxoethyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2cccnc2)cc(C(=O)CNS(=O)(=O)c2ccccc2)c1F |
| InChI | InChI=1S/C20H17FN2O3S/c1-14-10-16(15-6-5-9-22-12-15)11-18(20(14)21)19(24)13-23-27(25,26)17-7-3-2-4-8-17/h2-12,23H,13H2,1H3 |
| InChIKey | DLXINDNRMMPYOO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |