C16H22ClFN2O3S — CID 134581056
3-chloro-N'-(cyclohexylmethylsulfonyl)-5-ethyl-2-fluorobenzohydrazide (PubChem CID 134581056) has the molecular formula C16H22ClFN2O3S and a molecular weight of 376.88 g/mol. Its IUPAC name is 3-chloro-N'-(cyclohexylmethylsulfonyl)-5-ethyl-2-fluorobenzohydrazide.
| Compound Name | 3-chloro-N'-(cyclohexylmethylsulfonyl)-5-ethyl-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 134581056 |
| Molecular Formula | C16H22ClFN2O3S |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-chloro-N'-(cyclohexylmethylsulfonyl)-5-ethyl-2-fluorobenzohydrazide |
| SMILES | CCc1cc(Cl)c(F)c(C(=O)NNS(=O)(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C16H22ClFN2O3S/c1-2-11-8-13(15(18)14(17)9-11)16(21)19-20-24(22,23)10-12-6-4-3-5-7-12/h8-9,12,20H,2-7,10H2,1H3,(H,19,21) |
| InChIKey | NSIGDEYANXEKGH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|