C13H16ClFN2O3S — CID 65388548
5-chloro-N-(cyclopentylmethyl)-2-fluoro-3-sulfamoylbenzamide (PubChem CID 65388548) has the molecular formula C13H16ClFN2O3S and a molecular weight of 334.80 g/mol. Its IUPAC name is 5-chloro-N-(cyclopentylmethyl)-2-fluoro-3-sulfamoylbenzamide.
| Compound Name | 5-chloro-N-(cyclopentylmethyl)-2-fluoro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65388548 |
| Molecular Formula | C13H16ClFN2O3S |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 5-chloro-N-(cyclopentylmethyl)-2-fluoro-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(Cl)cc(C(=O)NCC2CCCC2)c1F |
| InChI | InChI=1S/C13H16ClFN2O3S/c14-9-5-10(12(15)11(6-9)21(16,19)20)13(18)17-7-8-3-1-2-4-8/h5-6,8H,1-4,7H2,(H,17,18)(H2,16,19,20) |
| InChIKey | JZEJTBKGFVCTEU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |