C11H13FN2O3S — CID 60727294
N-(cyclopropylmethyl)-2-fluoro-5-sulfamoylbenzamide (PubChem CID 60727294) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-fluoro-5-sulfamoylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-2-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 60727294 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(cyclopropylmethyl)-2-fluoro-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C11H13FN2O3S/c12-10-4-3-8(18(13,16)17)5-9(10)11(15)14-6-7-1-2-7/h3-5,7H,1-2,6H2,(H,14,15)(H2,13,16,17) |
| InChIKey | BKEDSKWAMLQUIZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |