C11H15FN2O5S2 — CID 74236642
N-(2-ethylsulfonylethyl)-2-fluoro-5-sulfamoylbenzamide (PubChem CID 74236642) has the molecular formula C11H15FN2O5S2 and a molecular weight of 338.38 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-2-fluoro-5-sulfamoylbenzamide.
| Compound Name | N-(2-ethylsulfonylethyl)-2-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 74236642 |
| Molecular Formula | C11H15FN2O5S2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-2-fluoro-5-sulfamoylbenzamide |
| SMILES | CCS(=O)(=O)CCNC(=O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C11H15FN2O5S2/c1-2-20(16,17)6-5-14-11(15)9-7-8(21(13,18)19)3-4-10(9)12/h3-4,7H,2,5-6H2,1H3,(H,14,15)(H2,13,18,19) |
| InChIKey | AGIKVRQPHRQKTO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |