C17H19FN2O4S — CID 74246247
N-[2-(2-ethoxyphenyl)ethyl]-2-fluoro-5-sulfamoylbenzamide (PubChem CID 74246247) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is N-[2-(2-ethoxyphenyl)ethyl]-2-fluoro-5-sulfamoylbenzamide.
| Compound Name | N-[2-(2-ethoxyphenyl)ethyl]-2-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 74246247 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[2-(2-ethoxyphenyl)ethyl]-2-fluoro-5-sulfamoylbenzamide |
| SMILES | CCOc1ccccc1CCNC(=O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C17H19FN2O4S/c1-2-24-16-6-4-3-5-12(16)9-10-20-17(21)14-11-13(25(19,22)23)7-8-15(14)18/h3-8,11H,2,9-10H2,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | PQRDIXHXSHFMDT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |