C9H8F4N2O3S — CID 60638089
2-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 60638089) has the molecular formula C9H8F4N2O3S and a molecular weight of 300.23 g/mol. Its IUPAC name is 2-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 60638089 |
| Molecular Formula | C9H8F4N2O3S |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-fluoro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F4N2O3S/c10-7-2-1-5(19(14,17)18)3-6(7)8(16)15-4-9(11,12)13/h1-3H,4H2,(H,15,16)(H2,14,17,18) |
| InChIKey | CIQQQBSCAJWILZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |