C9H7F5N2O3S — CID 62091869
2,6-difluoro-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 62091869) has the molecular formula C9H7F5N2O3S and a molecular weight of 318.22 g/mol. Its IUPAC name is 2,6-difluoro-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2,6-difluoro-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 62091869 |
| Molecular Formula | C9H7F5N2O3S |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2,6-difluoro-3-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)NCC(F)(F)F)c1F |
| InChI | InChI=1S/C9H7F5N2O3S/c10-4-1-2-5(20(15,18)19)7(11)6(4)8(17)16-3-9(12,13)14/h1-2H,3H2,(H,16,17)(H2,15,18,19) |
| InChIKey | WXOWOBRGEPFXGY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |