C12H16F2N2O3S — CID 65387884
2,6-difluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide (PubChem CID 65387884) has the molecular formula C12H16F2N2O3S and a molecular weight of 306.33 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide.
| Compound Name | 2,6-difluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387884 |
| Molecular Formula | C12H16F2N2O3S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2,6-difluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide |
| SMILES | CCC(C)CNC(=O)c1c(F)ccc(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C12H16F2N2O3S/c1-3-7(2)6-16-12(17)10-8(13)4-5-9(11(10)14)20(15,18)19/h4-5,7H,3,6H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | VCZRUXAJPXGVFC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |