C12H16BrClN2O3S — CID 65388652
4-bromo-2-chloro-N-(2-methylbutyl)-5-sulfamoylbenzamide (PubChem CID 65388652) has the molecular formula C12H16BrClN2O3S and a molecular weight of 383.70 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2-methylbutyl)-5-sulfamoylbenzamide.
| Compound Name | 4-bromo-2-chloro-N-(2-methylbutyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65388652 |
| Molecular Formula | C12H16BrClN2O3S |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 4-bromo-2-chloro-N-(2-methylbutyl)-5-sulfamoylbenzamide |
| SMILES | CCC(C)CNC(=O)c1cc(S(N)(=O)=O)c(Br)cc1Cl |
| InChI | InChI=1S/C12H16BrClN2O3S/c1-3-7(2)6-16-12(17)8-4-11(20(15,18)19)9(13)5-10(8)14/h4-5,7H,3,6H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | BNUFWFNRLIZGDM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |