C12H16Cl2N2O4S — CID 115665377
2,4-dichloro-N-(2-ethoxypropyl)-5-sulfamoylbenzamide (PubChem CID 115665377) has the molecular formula C12H16Cl2N2O4S and a molecular weight of 355.24 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-ethoxypropyl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N-(2-ethoxypropyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115665377 |
| Molecular Formula | C12H16Cl2N2O4S |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2,4-dichloro-N-(2-ethoxypropyl)-5-sulfamoylbenzamide |
| SMILES | CCOC(C)CNC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O4S/c1-3-20-7(2)6-16-12(17)8-4-11(21(15,18)19)10(14)5-9(8)13/h4-5,7H,3,6H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | SPBKPEAAOFASRF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |