C10H12Cl2N2O4S — CID 126508709
2,4-dichloro-N-(3-hydroxypropyl)-5-sulfamoylbenzamide (PubChem CID 126508709) has the molecular formula C10H12Cl2N2O4S and a molecular weight of 327.19 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-hydroxypropyl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N-(3-hydroxypropyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 126508709 |
| Molecular Formula | C10H12Cl2N2O4S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 2,4-dichloro-N-(3-hydroxypropyl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCCO)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O4S/c11-7-5-8(12)9(19(13,17)18)4-6(7)10(16)14-2-1-3-15/h4-5,15H,1-3H2,(H,14,16)(H2,13,17,18) |
| InChIKey | OZBGWVAREHIEDY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|