C16H18Cl4N4O8S2 — CID 50942703
bis(2,4-dichloro-5-sulfamoylbenzoic acid);ethane-1,2-diamine (PubChem CID 50942703) has the molecular formula C16H18Cl4N4O8S2 and a molecular weight of 600.29 g/mol. Its IUPAC name is bis(2,4-dichloro-5-sulfamoylbenzoic acid);ethane-1,2-diamine.
| Compound Name | bis(2,4-dichloro-5-sulfamoylbenzoic acid);ethane-1,2-diamine |
|---|---|
| PubChem CID | 50942703 |
| Molecular Formula | C16H18Cl4N4O8S2 |
| Molecular Weight | 600.29 g/mol |
| Exact Mass | 597.93 |
| IUPAC Name | bis(2,4-dichloro-5-sulfamoylbenzoic acid);ethane-1,2-diamine |
| SMILES | NCCN.NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl.NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/2C7H5Cl2NO4S.C2H8N2/c2*8-4-2-5(9)6(15(10,13)14)1-3(4)7(11)12;3-1-2-4/h2*1-2H,(H,11,12)(H2,10,13,14);1-4H2 |
| InChIKey | HUBXWUDJPGVEOP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 246.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |