C12H14Cl2O5S — CID 79354760
2,4-dichloro-5-(3-hydroxy-3-methylbutyl)sulfonylbenzoic acid (PubChem CID 79354760) has the molecular formula C12H14Cl2O5S and a molecular weight of 341.21 g/mol. Its IUPAC name is 2,4-dichloro-5-(3-hydroxy-3-methylbutyl)sulfonylbenzoic acid.
| Compound Name | 2,4-dichloro-5-(3-hydroxy-3-methylbutyl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 79354760 |
| Molecular Formula | C12H14Cl2O5S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2,4-dichloro-5-(3-hydroxy-3-methylbutyl)sulfonylbenzoic acid |
| SMILES | CC(C)(O)CCS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O5S/c1-12(2,17)3-4-20(18,19)10-5-7(11(15)16)8(13)6-9(10)14/h5-6,17H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | REBPODJDDPOZML-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |