C12H15Cl2NO5S — CID 65108091
2,4-dichloro-5-[(2-hydroxy-2-methylbutyl)sulfamoyl]benzoic acid (PubChem CID 65108091) has the molecular formula C12H15Cl2NO5S and a molecular weight of 356.23 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-hydroxy-2-methylbutyl)sulfamoyl]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(2-hydroxy-2-methylbutyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 65108091 |
| Molecular Formula | C12H15Cl2NO5S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2,4-dichloro-5-[(2-hydroxy-2-methylbutyl)sulfamoyl]benzoic acid |
| SMILES | CCC(C)(O)CNS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO5S/c1-3-12(2,18)6-15-21(19,20)10-4-7(11(16)17)8(13)5-9(10)14/h4-5,15,18H,3,6H2,1-2H3,(H,16,17) |
| InChIKey | SLQNHKJBCMDXEX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |