C9H7Cl2F2NO4S — CID 115405532
2,4-dichloro-5-(2,2-difluoroethylsulfamoyl)benzoic acid (PubChem CID 115405532) has the molecular formula C9H7Cl2F2NO4S and a molecular weight of 334.13 g/mol. Its IUPAC name is 2,4-dichloro-5-(2,2-difluoroethylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(2,2-difluoroethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 115405532 |
| Molecular Formula | C9H7Cl2F2NO4S |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 2,4-dichloro-5-(2,2-difluoroethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2F2NO4S/c10-5-2-6(11)7(1-4(5)9(15)16)19(17,18)14-3-8(12)13/h1-2,8,14H,3H2,(H,15,16) |
| InChIKey | FGWYVEWOSYBJED-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |